C19H21ClN2O4 — CID 56997059
[(3-chlorophenyl)carbamoylamino] 3,3-dimethyl-2-phenoxybutanoate (PubChem CID 56997059) has the molecular formula C19H21ClN2O4 and a molecular weight of 376.84 g/mol. Its IUPAC name is [(3-chlorophenyl)carbamoylamino] 3,3-dimethyl-2-phenoxybutanoate.
| Compound Name | [(3-chlorophenyl)carbamoylamino] 3,3-dimethyl-2-phenoxybutanoate |
|---|---|
| PubChem CID | 56997059 |
| Molecular Formula | C19H21ClN2O4 |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [(3-chlorophenyl)carbamoylamino] 3,3-dimethyl-2-phenoxybutanoate |
| SMILES | CC(C)(C)C(Oc1ccccc1)C(=O)ONC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H21ClN2O4/c1-19(2,3)16(25-15-10-5-4-6-11-15)17(23)26-22-18(24)21-14-9-7-8-13(20)12-14/h4-12,16H,1-3H3,(H2,21,22,24) |
| InChIKey | JFFWKHSAKJZMMX-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|