C27H29NO4S — CID 56998088
2-benzyl-7-hydroxy-7-(4-methoxyphenyl)-4-thiophen-3-yl-1,3,4,5,6,7a-hexahydroisoindole-3a-carboxylic acid (PubChem CID 56998088) has the molecular formula C27H29NO4S and a molecular weight of 463.60 g/mol. Its IUPAC name is 2-benzyl-7-hydroxy-7-(4-methoxyphenyl)-4-thiophen-3-yl-1,3,4,5,6,7a-hexahydroisoindole-3a-carboxylic acid.
| Compound Name | 2-benzyl-7-hydroxy-7-(4-methoxyphenyl)-4-thiophen-3-yl-1,3,4,5,6,7a-hexahydroisoindole-3a-carboxylic acid |
|---|---|
| PubChem CID | 56998088 |
| Molecular Formula | C27H29NO4S |
| Molecular Weight | 463.60 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | 2-benzyl-7-hydroxy-7-(4-methoxyphenyl)-4-thiophen-3-yl-1,3,4,5,6,7a-hexahydroisoindole-3a-carboxylic acid |
| SMILES | COc1ccc(C2(O)CCC(c3ccsc3)C3(C(=O)O)CN(Cc4ccccc4)CC23)cc1 |
| InChI | InChI=1S/C27H29NO4S/c1-32-22-9-7-21(8-10-22)27(31)13-11-23(20-12-14-33-17-20)26(25(29)30)18-28(16-24(26)27)15-19-5-3-2-4-6-19/h2-10,12,14,17,23-24,31H,11,13,15-16,18H2,1H3,(H,29,30) |
| InChIKey | UKLUDAFNPDMDDL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.60 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |