C23H27N3O3 — CID 57265870
2-benzyl-7-hydrazinylidene-4-(2-methoxyphenyl)-1,3,4,5,6,7a-hexahydroisoindole-3a-carboxylic acid (PubChem CID 57265870) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-benzyl-7-hydrazinylidene-4-(2-methoxyphenyl)-1,3,4,5,6,7a-hexahydroisoindole-3a-carboxylic acid.
| Compound Name | 2-benzyl-7-hydrazinylidene-4-(2-methoxyphenyl)-1,3,4,5,6,7a-hexahydroisoindole-3a-carboxylic acid |
|---|---|
| PubChem CID | 57265870 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-benzyl-7-hydrazinylidene-4-(2-methoxyphenyl)-1,3,4,5,6,7a-hexahydroisoindole-3a-carboxylic acid |
| SMILES | COc1ccccc1C1CCC(=NN)C2CN(Cc3ccccc3)CC21C(=O)O |
| InChI | InChI=1S/C23H27N3O3/c1-29-21-10-6-5-9-17(21)18-11-12-20(25-24)19-14-26(15-23(18,19)22(27)28)13-16-7-3-2-4-8-16/h2-10,18-19H,11-15,24H2,1H3,(H,27,28) |
| InChIKey | NSQMZCDMLNBXCB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|