C24H29N3O3 — CID 70273035
2-benzyl-7-hydrazinylidene-4-(2-methoxyphenyl)-1-methyl-1,3,4,5,6,7a-hexahydroisoindole-3a-carboxylic acid (PubChem CID 70273035) has the molecular formula C24H29N3O3 and a molecular weight of 407.51 g/mol. Its IUPAC name is 2-benzyl-7-hydrazinylidene-4-(2-methoxyphenyl)-1-methyl-1,3,4,5,6,7a-hexahydroisoindole-3a-carboxylic acid.
| Compound Name | 2-benzyl-7-hydrazinylidene-4-(2-methoxyphenyl)-1-methyl-1,3,4,5,6,7a-hexahydroisoindole-3a-carboxylic acid |
|---|---|
| PubChem CID | 70273035 |
| Molecular Formula | C24H29N3O3 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-benzyl-7-hydrazinylidene-4-(2-methoxyphenyl)-1-methyl-1,3,4,5,6,7a-hexahydroisoindole-3a-carboxylic acid |
| SMILES | COc1ccccc1C1CCC(=NN)C2C(C)N(Cc3ccccc3)CC12C(=O)O |
| InChI | InChI=1S/C24H29N3O3/c1-16-22-20(26-25)13-12-19(18-10-6-7-11-21(18)30-2)24(22,23(28)29)15-27(16)14-17-8-4-3-5-9-17/h3-11,16,19,22H,12-15,25H2,1-2H3,(H,28,29) |
| InChIKey | RQLCFDUGJWDILA-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|