C18H28ClN3O4S — CID 57001896
1-(4-amino-5-chloro-2-methoxyphenyl)-3-[1-(2-amino-2-methylsulfonylethyl)piperidin-4-yl]propan-2-one (PubChem CID 57001896) has the molecular formula C18H28ClN3O4S and a molecular weight of 417.96 g/mol. Its IUPAC name is 1-(4-amino-5-chloro-2-methoxyphenyl)-3-[1-(2-amino-2-methylsulfonylethyl)piperidin-4-yl]propan-2-one.
| Compound Name | 1-(4-amino-5-chloro-2-methoxyphenyl)-3-[1-(2-amino-2-methylsulfonylethyl)piperidin-4-yl]propan-2-one |
|---|---|
| PubChem CID | 57001896 |
| Molecular Formula | C18H28ClN3O4S |
| Molecular Weight | 417.96 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 1-(4-amino-5-chloro-2-methoxyphenyl)-3-[1-(2-amino-2-methylsulfonylethyl)piperidin-4-yl]propan-2-one |
| SMILES | COc1cc(N)c(Cl)cc1CC(=O)CC1CCN(CC(N)S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C18H28ClN3O4S/c1-26-17-10-16(20)15(19)9-13(17)8-14(23)7-12-3-5-22(6-4-12)11-18(21)27(2,24)25/h9-10,12,18H,3-8,11,20-21H2,1-2H3 |
| InChIKey | NZDVVJLSUVWKAD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 115.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.96 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|