C19H31ClN4O4S — CID 67740662
4-[3-(4-amino-5-chloro-2-methoxyphenyl)-2-oxopropyl]-1-[2-(dimethylsulfamoylamino)ethyl]piperidine (PubChem CID 67740662) has the molecular formula C19H31ClN4O4S and a molecular weight of 447.00 g/mol. Its IUPAC name is 4-[3-(4-amino-5-chloro-2-methoxyphenyl)-2-oxopropyl]-1-[2-(dimethylsulfamoylamino)ethyl]piperidine.
| Compound Name | 4-[3-(4-amino-5-chloro-2-methoxyphenyl)-2-oxopropyl]-1-[2-(dimethylsulfamoylamino)ethyl]piperidine |
|---|---|
| PubChem CID | 67740662 |
| Molecular Formula | C19H31ClN4O4S |
| Molecular Weight | 447.00 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 4-[3-(4-amino-5-chloro-2-methoxyphenyl)-2-oxopropyl]-1-[2-(dimethylsulfamoylamino)ethyl]piperidine |
| SMILES | COc1cc(N)c(Cl)cc1CC(=O)CC1CCN(CCNS(=O)(=O)N(C)C)CC1 |
| InChI | InChI=1S/C19H31ClN4O4S/c1-23(2)29(26,27)22-6-9-24-7-4-14(5-8-24)10-16(25)11-15-12-17(20)18(21)13-19(15)28-3/h12-14,22H,4-11,21H2,1-3H3 |
| InChIKey | SLBDQKCVSDPBJR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.00 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|