C15H24O2 — CID 57007885
(2S,3R)-2-deca-2,4,6-trien-2-yloxan-3-ol (PubChem CID 57007885) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is (2S,3R)-2-deca-2,4,6-trien-2-yloxan-3-ol.
| Compound Name | (2S,3R)-2-deca-2,4,6-trien-2-yloxan-3-ol |
|---|---|
| PubChem CID | 57007885 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | (2S,3R)-2-deca-2,4,6-trien-2-yloxan-3-ol |
| SMILES | CCCC=CC=CC=C(C)[C@@H]1OCCC[C@H]1O |
| InChI | InChI=1S/C15H24O2/c1-3-4-5-6-7-8-10-13(2)15-14(16)11-9-12-17-15/h5-8,10,14-16H,3-4,9,11-12H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | APJLBGCPJFOCDU-CABCVRRESA-N |
| XLogP | 3.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|