C19H21BO5 — CID 57010200
2,2-bis(oxiran-2-yl)propyl diphenyl borate (PubChem CID 57010200) has the molecular formula C19H21BO5 and a molecular weight of 340.18 g/mol. Its IUPAC name is 2,2-bis(oxiran-2-yl)propyl diphenyl borate.
| Compound Name | 2,2-bis(oxiran-2-yl)propyl diphenyl borate |
|---|---|
| PubChem CID | 57010200 |
| Molecular Formula | C19H21BO5 |
| Molecular Weight | 340.18 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 2,2-bis(oxiran-2-yl)propyl diphenyl borate |
| SMILES | CC(COB(Oc1ccccc1)Oc1ccccc1)(C1CO1)C1CO1 |
| InChI | InChI=1S/C19H21BO5/c1-19(17-12-21-17,18-13-22-18)14-23-20(24-15-8-4-2-5-9-15)25-16-10-6-3-7-11-16/h2-11,17-18H,12-14H2,1H3 |
| InChIKey | QULBPHMMGUMWQU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 52.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|