C15H8F9NO — CID 57012463
2,5-bis(trifluoromethyl)-3-[2-(trifluoromethyl)phenoxy]aniline (PubChem CID 57012463) has the molecular formula C15H8F9NO and a molecular weight of 389.22 g/mol. Its IUPAC name is 2,5-bis(trifluoromethyl)-3-[2-(trifluoromethyl)phenoxy]aniline.
| Compound Name | 2,5-bis(trifluoromethyl)-3-[2-(trifluoromethyl)phenoxy]aniline |
|---|---|
| PubChem CID | 57012463 |
| Molecular Formula | C15H8F9NO |
| Molecular Weight | 389.22 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 2,5-bis(trifluoromethyl)-3-[2-(trifluoromethyl)phenoxy]aniline |
| SMILES | Nc1cc(C(F)(F)F)cc(Oc2ccccc2C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C15H8F9NO/c16-13(17,18)7-5-9(25)12(15(22,23)24)11(6-7)26-10-4-2-1-3-8(10)14(19,20)21/h1-6H,25H2 |
| InChIKey | CHRITAGGUBGDDC-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.22 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|