C16H36N2 — CID 57014442
1-(2-ethylhexyl)-2-(2,4,4-trimethylpentan-2-yl)hydrazine (PubChem CID 57014442) has the molecular formula C16H36N2 and a molecular weight of 256.48 g/mol. Its IUPAC name is 1-(2-ethylhexyl)-2-(2,4,4-trimethylpentan-2-yl)hydrazine.
| Compound Name | 1-(2-ethylhexyl)-2-(2,4,4-trimethylpentan-2-yl)hydrazine |
|---|---|
| PubChem CID | 57014442 |
| Molecular Formula | C16H36N2 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.29 |
| IUPAC Name | 1-(2-ethylhexyl)-2-(2,4,4-trimethylpentan-2-yl)hydrazine |
| SMILES | CCCCC(CC)CNNC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H36N2/c1-8-10-11-14(9-2)12-17-18-16(6,7)13-15(3,4)5/h14,17-18H,8-13H2,1-7H3 |
| InChIKey | HDYFOMVZCVSNOK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|