C17H27NO2 — CID 57019343
N-benzyl-N-ethenyl-4,4-diethoxybutan-1-amine (PubChem CID 57019343) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is N-benzyl-N-ethenyl-4,4-diethoxybutan-1-amine.
| Compound Name | N-benzyl-N-ethenyl-4,4-diethoxybutan-1-amine |
|---|---|
| PubChem CID | 57019343 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-benzyl-N-ethenyl-4,4-diethoxybutan-1-amine |
| SMILES | C=CN(CCCC(OCC)OCC)Cc1ccccc1 |
| InChI | InChI=1S/C17H27NO2/c1-4-18(15-16-11-8-7-9-12-16)14-10-13-17(19-5-2)20-6-3/h4,7-9,11-12,17H,1,5-6,10,13-15H2,2-3H3 |
| InChIKey | CEIGZCZGAWKUTP-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|