C23H35ClN2O — CID 57020288
7-[chloro(phenyl)methylidene]-N-[2-(diethylamino)ethoxy]-2-propylcyclohepten-1-amine (PubChem CID 57020288) has the molecular formula C23H35ClN2O and a molecular weight of 391.00 g/mol. Its IUPAC name is 7-[chloro(phenyl)methylidene]-N-[2-(diethylamino)ethoxy]-2-propylcyclohepten-1-amine.
| Compound Name | 7-[chloro(phenyl)methylidene]-N-[2-(diethylamino)ethoxy]-2-propylcyclohepten-1-amine |
|---|---|
| PubChem CID | 57020288 |
| Molecular Formula | C23H35ClN2O |
| Molecular Weight | 391.00 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | 7-[chloro(phenyl)methylidene]-N-[2-(diethylamino)ethoxy]-2-propylcyclohepten-1-amine |
| SMILES | CCCC1=C(NOCCN(CC)CC)C(=C(Cl)c2ccccc2)CCCC1 |
| InChI | InChI=1S/C23H35ClN2O/c1-4-12-20-15-10-11-16-21(22(24)19-13-8-7-9-14-19)23(20)25-27-18-17-26(5-2)6-3/h7-9,13-14,25H,4-6,10-12,15-18H2,1-3H3 |
| InChIKey | HQKISYLDFAKSTC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.00 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|