C22H34N2O2S2 — CID 57020561
N-[4-[6-(1-thiophen-3-ylpentan-2-ylamino)hexan-3-yl]phenyl]methanesulfonamide (PubChem CID 57020561) has the molecular formula C22H34N2O2S2 and a molecular weight of 422.66 g/mol. Its IUPAC name is N-[4-[6-(1-thiophen-3-ylpentan-2-ylamino)hexan-3-yl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[6-(1-thiophen-3-ylpentan-2-ylamino)hexan-3-yl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 57020561 |
| Molecular Formula | C22H34N2O2S2 |
| Molecular Weight | 422.66 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | N-[4-[6-(1-thiophen-3-ylpentan-2-ylamino)hexan-3-yl]phenyl]methanesulfonamide |
| SMILES | CCCC(Cc1ccsc1)NCCCC(CC)c1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C22H34N2O2S2/c1-4-7-22(16-18-13-15-27-17-18)23-14-6-8-19(5-2)20-9-11-21(12-10-20)24-28(3,25)26/h9-13,15,17,19,22-24H,4-8,14,16H2,1-3H3 |
| InChIKey | ZNSVGISDYMAIEG-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.66 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|