C19H28N2O3S2 — CID 57060861
N-[4-[1-(1-thiophen-3-ylpropan-2-ylamino)pentan-3-yloxy]phenyl]methanesulfonamide (PubChem CID 57060861) has the molecular formula C19H28N2O3S2 and a molecular weight of 396.58 g/mol. Its IUPAC name is N-[4-[1-(1-thiophen-3-ylpropan-2-ylamino)pentan-3-yloxy]phenyl]methanesulfonamide.
| Compound Name | N-[4-[1-(1-thiophen-3-ylpropan-2-ylamino)pentan-3-yloxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 57060861 |
| Molecular Formula | C19H28N2O3S2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | N-[4-[1-(1-thiophen-3-ylpropan-2-ylamino)pentan-3-yloxy]phenyl]methanesulfonamide |
| SMILES | CCC(CCNC(C)Cc1ccsc1)Oc1ccc(NS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H28N2O3S2/c1-4-18(9-11-20-15(2)13-16-10-12-25-14-16)24-19-7-5-17(6-8-19)21-26(3,22)23/h5-8,10,12,14-15,18,20-21H,4,9,11,13H2,1-3H3 |
| InChIKey | NMORUSKWIOXFGS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |