C17H24N2OS — CID 57231919
4-[1-(1-thiophen-3-ylpropan-2-ylamino)butan-2-yloxy]aniline (PubChem CID 57231919) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 4-[1-(1-thiophen-3-ylpropan-2-ylamino)butan-2-yloxy]aniline.
| Compound Name | 4-[1-(1-thiophen-3-ylpropan-2-ylamino)butan-2-yloxy]aniline |
|---|---|
| PubChem CID | 57231919 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-[1-(1-thiophen-3-ylpropan-2-ylamino)butan-2-yloxy]aniline |
| SMILES | CCC(CNC(C)Cc1ccsc1)Oc1ccc(N)cc1 |
| InChI | InChI=1S/C17H24N2OS/c1-3-16(20-17-6-4-15(18)5-7-17)11-19-13(2)10-14-8-9-21-12-14/h4-9,12-13,16,19H,3,10-11,18H2,1-2H3 |
| InChIKey | LTGPOBKHJJJANY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|