C22H26ClNO2 — CID 57021175
2-(4-chlorophenyl)-1-[2-hydroxy-5-[4-(methylaminomethyl)phenyl]cyclohexyl]ethanone (PubChem CID 57021175) has the molecular formula C22H26ClNO2 and a molecular weight of 371.91 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[2-hydroxy-5-[4-(methylaminomethyl)phenyl]cyclohexyl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-[2-hydroxy-5-[4-(methylaminomethyl)phenyl]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 57021175 |
| Molecular Formula | C22H26ClNO2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[2-hydroxy-5-[4-(methylaminomethyl)phenyl]cyclohexyl]ethanone |
| SMILES | CNCc1ccc(C2CCC(O)C(C(=O)Cc3ccc(Cl)cc3)C2)cc1 |
| InChI | InChI=1S/C22H26ClNO2/c1-24-14-16-2-6-17(7-3-16)18-8-11-21(25)20(13-18)22(26)12-15-4-9-19(23)10-5-15/h2-7,9-10,18,20-21,24-25H,8,11-14H2,1H3 |
| InChIKey | XSIYVNCFWBVYER-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |