C30H36ClNO2 — CID 57062943
2-(4-chlorophenyl)-1-[2-hydroxy-5-[4-[(2-pentylpyrrol-2-yl)methyl]phenyl]cyclohexyl]ethanone (PubChem CID 57062943) has the molecular formula C30H36ClNO2 and a molecular weight of 478.08 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[2-hydroxy-5-[4-[(2-pentylpyrrol-2-yl)methyl]phenyl]cyclohexyl]ethanone.
| Compound Name | 2-(4-chlorophenyl)-1-[2-hydroxy-5-[4-[(2-pentylpyrrol-2-yl)methyl]phenyl]cyclohexyl]ethanone |
|---|---|
| PubChem CID | 57062943 |
| Molecular Formula | C30H36ClNO2 |
| Molecular Weight | 478.08 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[2-hydroxy-5-[4-[(2-pentylpyrrol-2-yl)methyl]phenyl]cyclohexyl]ethanone |
| SMILES | CCCCCC1(Cc2ccc(C3CCC(O)C(C(=O)Cc4ccc(Cl)cc4)C3)cc2)C=CC=N1 |
| InChI | InChI=1S/C30H36ClNO2/c1-2-3-4-16-30(17-5-18-32-30)21-23-6-10-24(11-7-23)25-12-15-28(33)27(20-25)29(34)19-22-8-13-26(31)14-9-22/h5-11,13-14,17-18,25,27-28,33H,2-4,12,15-16,19-21H2,1H3 |
| InChIKey | UCEMXAVQEKDGDP-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.08 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|