C24H29FN2O5 — CID 57022051
benzyl N-[(2S)-2-amino-4-methylpentanoyl]-N-[4-(2-fluorophenoxy)-1-oxobutan-2-yl]carbamate (PubChem CID 57022051) has the molecular formula C24H29FN2O5 and a molecular weight of 444.50 g/mol. Its IUPAC name is benzyl N-[(2S)-2-amino-4-methylpentanoyl]-N-[4-(2-fluorophenoxy)-1-oxobutan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-2-amino-4-methylpentanoyl]-N-[4-(2-fluorophenoxy)-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 57022051 |
| Molecular Formula | C24H29FN2O5 |
| Molecular Weight | 444.50 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | benzyl N-[(2S)-2-amino-4-methylpentanoyl]-N-[4-(2-fluorophenoxy)-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C[C@H](N)C(=O)N(C(=O)OCc1ccccc1)C(C=O)CCOc1ccccc1F |
| InChI | InChI=1S/C24H29FN2O5/c1-17(2)14-21(26)23(29)27(24(30)32-16-18-8-4-3-5-9-18)19(15-28)12-13-31-22-11-7-6-10-20(22)25/h3-11,15,17,19,21H,12-14,16,26H2,1-2H3/t19?,21-/m0/s1 |
| InChIKey | VERAZEFNWRLUAX-QWAKEFERSA-N |
| XLogP | 3.70 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|