C20H18O12 — CID 57022953
4-[4-(3-carboxy-3-prop-2-enoyloxypropanoyl)oxyphenoxy]-4-oxo-2-prop-2-enoyloxybutanoic acid (PubChem CID 57022953) has the molecular formula C20H18O12 and a molecular weight of 450.35 g/mol. Its IUPAC name is 4-[4-(3-carboxy-3-prop-2-enoyloxypropanoyl)oxyphenoxy]-4-oxo-2-prop-2-enoyloxybutanoic acid.
| Compound Name | 4-[4-(3-carboxy-3-prop-2-enoyloxypropanoyl)oxyphenoxy]-4-oxo-2-prop-2-enoyloxybutanoic acid |
|---|---|
| PubChem CID | 57022953 |
| Molecular Formula | C20H18O12 |
| Molecular Weight | 450.35 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 4-[4-(3-carboxy-3-prop-2-enoyloxypropanoyl)oxyphenoxy]-4-oxo-2-prop-2-enoyloxybutanoic acid |
| SMILES | C=CC(=O)OC(CC(=O)Oc1ccc(OC(=O)CC(OC(=O)C=C)C(=O)O)cc1)C(=O)O |
| InChI | InChI=1S/C20H18O12/c1-3-15(21)31-13(19(25)26)9-17(23)29-11-5-7-12(8-6-11)30-18(24)10-14(20(27)28)32-16(22)4-2/h3-8,13-14H,1-2,9-10H2,(H,25,26)(H,27,28) |
| InChIKey | OTMNYQQPKUUZSY-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|