C21H31NO2 — CID 57023963
1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]hex-2-en-1-one (PubChem CID 57023963) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]hex-2-en-1-one.
| Compound Name | 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]hex-2-en-1-one |
|---|---|
| PubChem CID | 57023963 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | 1-[5-[4-[(dimethylamino)methyl]phenyl]-2-hydroxycyclohexyl]hex-2-en-1-one |
| SMILES | CCCC=CC(=O)C1CC(c2ccc(CN(C)C)cc2)CCC1O |
| InChI | InChI=1S/C21H31NO2/c1-4-5-6-7-20(23)19-14-18(12-13-21(19)24)17-10-8-16(9-11-17)15-22(2)3/h6-11,18-19,21,24H,4-5,12-15H2,1-3H3 |
| InChIKey | NDDLVCPEEMFNAT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|