C9H15NO5S2 — CID 57028110
2-acetamido-2-[3,3-bis(sulfanyl)propyl]butanedioic acid (PubChem CID 57028110) has the molecular formula C9H15NO5S2 and a molecular weight of 281.35 g/mol. Its IUPAC name is 2-acetamido-2-[3,3-bis(sulfanyl)propyl]butanedioic acid.
| Compound Name | 2-acetamido-2-[3,3-bis(sulfanyl)propyl]butanedioic acid |
|---|---|
| PubChem CID | 57028110 |
| Molecular Formula | C9H15NO5S2 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.04 |
| IUPAC Name | 2-acetamido-2-[3,3-bis(sulfanyl)propyl]butanedioic acid |
| SMILES | CC(=O)NC(CCC(S)S)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H15NO5S2/c1-5(11)10-9(8(14)15,4-6(12)13)3-2-7(16)17/h7,16-17H,2-4H2,1H3,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | PJDJWWDNGUVIDS-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|