C13H16N2O6 — CID 57029343
1-[(2R,4S,5S)-4-hydroxy-5-(2-hydroxy-3-methylbut-3-enoyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 57029343) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-hydroxy-5-(2-hydroxy-3-methylbut-3-enoyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-hydroxy-5-(2-hydroxy-3-methylbut-3-enoyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 57029343 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 1-[(2R,4S,5S)-4-hydroxy-5-(2-hydroxy-3-methylbut-3-enoyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=C(C)C(O)C(=O)[C@H]1O[C@@H](n2ccc(=O)[nH]c2=O)C[C@@H]1O |
| InChI | InChI=1S/C13H16N2O6/c1-6(2)10(18)11(19)12-7(16)5-9(21-12)15-4-3-8(17)14-13(15)20/h3-4,7,9-10,12,16,18H,1,5H2,2H3,(H,14,17,20)/t7-,9+,10?,12-/m0/s1 |
| InChIKey | QJENRLIIVPHQIL-ZSGJPLKDSA-N |
| XLogP | -1.31 |
| TPSA | 121.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|