C24H35ClN2O — CID 57032361
2-butyl-6-[(4-chlorophenyl)methylidene]-N-[2-[(2R)-piperidin-2-yl]ethoxy]cyclohexen-1-amine (PubChem CID 57032361) has the molecular formula C24H35ClN2O and a molecular weight of 403.01 g/mol. Its IUPAC name is 2-butyl-6-[(4-chlorophenyl)methylidene]-N-[2-[(2R)-piperidin-2-yl]ethoxy]cyclohexen-1-amine.
| Compound Name | 2-butyl-6-[(4-chlorophenyl)methylidene]-N-[2-[(2R)-piperidin-2-yl]ethoxy]cyclohexen-1-amine |
|---|---|
| PubChem CID | 57032361 |
| Molecular Formula | C24H35ClN2O |
| Molecular Weight | 403.01 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 2-butyl-6-[(4-chlorophenyl)methylidene]-N-[2-[(2R)-piperidin-2-yl]ethoxy]cyclohexen-1-amine |
| SMILES | CCCCC1=C(NOCC[C@H]2CCCCN2)C(=Cc2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C24H35ClN2O/c1-2-3-7-20-8-6-9-21(18-19-11-13-22(25)14-12-19)24(20)27-28-17-15-23-10-4-5-16-26-23/h11-14,18,23,26-27H,2-10,15-17H2,1H3/t23-/m1/s1 |
| InChIKey | QKJIYSKVNZCHGW-HSZRJFAPSA-N |
| XLogP | 6.41 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.01 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|