C22H32ClN3O — CID 57121612
6-[(4-chlorophenyl)methylidene]-2-methyl-N-[3-(4-methylpiperazin-1-yl)propoxy]cyclohexen-1-amine (PubChem CID 57121612) has the molecular formula C22H32ClN3O and a molecular weight of 389.97 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methylidene]-2-methyl-N-[3-(4-methylpiperazin-1-yl)propoxy]cyclohexen-1-amine.
| Compound Name | 6-[(4-chlorophenyl)methylidene]-2-methyl-N-[3-(4-methylpiperazin-1-yl)propoxy]cyclohexen-1-amine |
|---|---|
| PubChem CID | 57121612 |
| Molecular Formula | C22H32ClN3O |
| Molecular Weight | 389.97 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 6-[(4-chlorophenyl)methylidene]-2-methyl-N-[3-(4-methylpiperazin-1-yl)propoxy]cyclohexen-1-amine |
| SMILES | CC1=C(NOCCCN2CCN(C)CC2)C(=Cc2ccc(Cl)cc2)CCC1 |
| InChI | InChI=1S/C22H32ClN3O/c1-18-5-3-6-20(17-19-7-9-21(23)10-8-19)22(18)24-27-16-4-11-26-14-12-25(2)13-15-26/h7-10,17,24H,3-6,11-16H2,1-2H3 |
| InChIKey | UELAVVHUMGRNEN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.97 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|