C23H31ClN2O — CID 57033566
5-[1-(2-chlorophenyl)ethenyl]-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)cyclohexa-1,5-dien-1-amine (PubChem CID 57033566) has the molecular formula C23H31ClN2O and a molecular weight of 386.97 g/mol. Its IUPAC name is 5-[1-(2-chlorophenyl)ethenyl]-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)cyclohexa-1,5-dien-1-amine.
| Compound Name | 5-[1-(2-chlorophenyl)ethenyl]-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)cyclohexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 57033566 |
| Molecular Formula | C23H31ClN2O |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 5-[1-(2-chlorophenyl)ethenyl]-3,3-dimethyl-N-(2-piperidin-1-ylethoxy)cyclohexa-1,5-dien-1-amine |
| SMILES | C=C(C1=CC(NOCCN2CCCCC2)=CC(C)(C)C1)c1ccccc1Cl |
| InChI | InChI=1S/C23H31ClN2O/c1-18(21-9-5-6-10-22(21)24)19-15-20(17-23(2,3)16-19)25-27-14-13-26-11-7-4-8-12-26/h5-6,9-10,15,17,25H,1,4,7-8,11-14,16H2,2-3H3 |
| InChIKey | MOSQDQCRIISCHG-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|