C22H33ClN2O — CID 57172335
1-(4-chlorophenyl)-N-(2-piperidin-1-ylethoxy)nona-1,3-dien-3-amine (PubChem CID 57172335) has the molecular formula C22H33ClN2O and a molecular weight of 376.97 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(2-piperidin-1-ylethoxy)nona-1,3-dien-3-amine.
| Compound Name | 1-(4-chlorophenyl)-N-(2-piperidin-1-ylethoxy)nona-1,3-dien-3-amine |
|---|---|
| PubChem CID | 57172335 |
| Molecular Formula | C22H33ClN2O |
| Molecular Weight | 376.97 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(2-piperidin-1-ylethoxy)nona-1,3-dien-3-amine |
| SMILES | CCCCCC=C(C=Cc1ccc(Cl)cc1)NOCCN1CCCCC1 |
| InChI | InChI=1S/C22H33ClN2O/c1-2-3-4-6-9-22(15-12-20-10-13-21(23)14-11-20)24-26-19-18-25-16-7-5-8-17-25/h9-15,24H,2-8,16-19H2,1H3 |
| InChIKey | FYZUIIKCICCJLQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.97 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|