C13H18NO3PS — CID 57032818
N-ethoxy-1-[methoxy(phenyl)phosphinothioyl]oxybuta-1,2-dien-1-amine (PubChem CID 57032818) has the molecular formula C13H18NO3PS and a molecular weight of 299.33 g/mol. Its IUPAC name is N-ethoxy-1-[methoxy(phenyl)phosphinothioyl]oxybuta-1,2-dien-1-amine.
| Compound Name | N-ethoxy-1-[methoxy(phenyl)phosphinothioyl]oxybuta-1,2-dien-1-amine |
|---|---|
| PubChem CID | 57032818 |
| Molecular Formula | C13H18NO3PS |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-ethoxy-1-[methoxy(phenyl)phosphinothioyl]oxybuta-1,2-dien-1-amine |
| SMILES | CC=C=C(NOCC)OP(=S)(OC)c1ccccc1 |
| InChI | InChI=1S/C13H18NO3PS/c1-4-9-13(14-16-5-2)17-18(19,15-3)12-10-7-6-8-11-12/h4,6-8,10-11,14H,5H2,1-3H3 |
| InChIKey | ATGROCBUKUORCS-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|