C14H16O5S — CID 57034373
methyl 6-(4-methylphenyl)sulfinyl-3,5-dioxohexanoate (PubChem CID 57034373) has the molecular formula C14H16O5S and a molecular weight of 296.34 g/mol. Its IUPAC name is methyl 6-(4-methylphenyl)sulfinyl-3,5-dioxohexanoate.
| Compound Name | methyl 6-(4-methylphenyl)sulfinyl-3,5-dioxohexanoate |
|---|---|
| PubChem CID | 57034373 |
| Molecular Formula | C14H16O5S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | methyl 6-(4-methylphenyl)sulfinyl-3,5-dioxohexanoate |
| SMILES | COC(=O)CC(=O)CC(=O)CS(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H16O5S/c1-10-3-5-13(6-4-10)20(18)9-12(16)7-11(15)8-14(17)19-2/h3-6H,7-9H2,1-2H3 |
| InChIKey | HODYVBIMPMDEGT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|