C8H10Cl2N2O — CID 57037383
2,2-dichloro-N-(1-cyanocyclopropyl)butanamide (PubChem CID 57037383) has the molecular formula C8H10Cl2N2O and a molecular weight of 221.09 g/mol. Its IUPAC name is 2,2-dichloro-N-(1-cyanocyclopropyl)butanamide.
| Compound Name | 2,2-dichloro-N-(1-cyanocyclopropyl)butanamide |
|---|---|
| PubChem CID | 57037383 |
| Molecular Formula | C8H10Cl2N2O |
| Molecular Weight | 221.09 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | 2,2-dichloro-N-(1-cyanocyclopropyl)butanamide |
| SMILES | CCC(Cl)(Cl)C(=O)NC1(C#N)CC1 |
| InChI | InChI=1S/C8H10Cl2N2O/c1-2-8(9,10)6(13)12-7(5-11)3-4-7/h2-4H2,1H3,(H,12,13) |
| InChIKey | WZZDJLBWSYQATI-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.09 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|