About N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide
N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide (PubChem CID 90305562) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide |
| PubChem CID | 90305562 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)NC1(C#N)CC1 |
| InChI | InChI=1S/C9H14N2O/c1-8(2,3)7(12)11-9(6-10)4-5-9/h4-5H2,1-3H3,(H,11,12) |
| InChIKey | OEYFQRSBZVZEEI-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide?
The IUPAC name of N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide (CID 90305562) is N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide.
What is the SMILES notation for N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide?
The canonical SMILES for N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide is CC(C)(C)C(=O)NC1(C#N)CC1.
What is the InChIKey of N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide?
The InChIKey is OEYFQRSBZVZEEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-8(2,3)7(12)11-9(6-10)4-5-9/h4-5H2,1-3H3,(H,11,12).
What are the key properties of N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide?
N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide has a molecular weight of 166.22 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1-cyanocyclopropyl)-2,2-dimethylpropanamide is sourced from PubChem (CID 90305562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).