C16H30N2O — CID 144998295
N-(1-cyanocyclopropyl)-2,2,5,5-tetramethylhexanamide;ethane (PubChem CID 144998295) has the molecular formula C16H30N2O and a molecular weight of 266.43 g/mol. Its IUPAC name is N-(1-cyanocyclopropyl)-2,2,5,5-tetramethylhexanamide;ethane.
| Compound Name | N-(1-cyanocyclopropyl)-2,2,5,5-tetramethylhexanamide;ethane |
|---|---|
| PubChem CID | 144998295 |
| Molecular Formula | C16H30N2O |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.24 |
| IUPAC Name | N-(1-cyanocyclopropyl)-2,2,5,5-tetramethylhexanamide;ethane |
| SMILES | CC.CC(C)(C)CCC(C)(C)C(=O)NC1(C#N)CC1 |
| InChI | InChI=1S/C14H24N2O.C2H6/c1-12(2,3)6-7-13(4,5)11(17)16-14(10-15)8-9-14;1-2/h6-9H2,1-5H3,(H,16,17);1-2H3 |
| InChIKey | OMUCGHIMJQHECP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |