C18H24N2O2 — CID 57039365
4-[3-[2-(2-hydroxyethyl)pyrrol-2-yl]-3-methylbutyl]benzamide (PubChem CID 57039365) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 4-[3-[2-(2-hydroxyethyl)pyrrol-2-yl]-3-methylbutyl]benzamide.
| Compound Name | 4-[3-[2-(2-hydroxyethyl)pyrrol-2-yl]-3-methylbutyl]benzamide |
|---|---|
| PubChem CID | 57039365 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 4-[3-[2-(2-hydroxyethyl)pyrrol-2-yl]-3-methylbutyl]benzamide |
| SMILES | CC(C)(CCc1ccc(C(N)=O)cc1)C1(CCO)C=CC=N1 |
| InChI | InChI=1S/C18H24N2O2/c1-17(2,18(11-13-21)9-3-12-20-18)10-8-14-4-6-15(7-5-14)16(19)22/h3-7,9,12,21H,8,10-11,13H2,1-2H3,(H2,19,22) |
| InChIKey | URIDYGRSVQNACW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |