About 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol
1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol (PubChem CID 57039996) has the molecular formula C22H22N4OS2
and a molecular weight of 422.58 g/mol. Its IUPAC name is 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol.
Molecular Properties
| Compound Name | 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol |
| PubChem CID | 57039996 |
| Molecular Formula | C22H22N4OS2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol |
| SMILES | Cn1ccnc1SCC(O)C(S)c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C22H22N4OS2/c1-26-13-12-23-22(26)29-14-17(27)20(28)21-24-18(15-8-4-2-5-9-15)19(25-21)16-10-6-3-7-11-16/h2-13,17,20,27-28H,14H2,1H3,(H,24,25) |
| InChIKey | ACCGFJSNHZEILS-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol?
The IUPAC name of 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol (CID 57039996) is 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol.
What is the SMILES notation for 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol?
The canonical SMILES for 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol is Cn1ccnc1SCC(O)C(S)c1nc(-c2ccccc2)c(-c2ccccc2)[nH]1.
What is the InChIKey of 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol?
The InChIKey is ACCGFJSNHZEILS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N4OS2/c1-26-13-12-23-22(26)29-14-17(27)20(28)21-24-18(15-8-4-2-5-9-15)19(25-21)16-10-6-3-7-11-16/h2-13,17,20,27-28H,14H2,1H3,(H,24,25).
What are the key properties of 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol?
1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol has a molecular weight of 422.58 g/mol, XLogP of 4.60, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4,5-diphenyl-1H-imidazol-2-yl)-3-(1-methylimidazol-2-yl)sulfanyl-1-sulfanylpropan-2-ol is sourced from PubChem (CID 57039996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).