C17H28N4O2S2 — CID 57040016
N'-[2-[[4-methyl-5-(piperidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide (PubChem CID 57040016) has the molecular formula C17H28N4O2S2 and a molecular weight of 384.57 g/mol. Its IUPAC name is N'-[2-[[4-methyl-5-(piperidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide.
| Compound Name | N'-[2-[[4-methyl-5-(piperidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide |
|---|---|
| PubChem CID | 57040016 |
| Molecular Formula | C17H28N4O2S2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N'-[2-[[4-methyl-5-(piperidin-1-ylmethyl)thiophen-2-yl]methylsulfanyl]ethyl]-2-nitropropanimidamide |
| SMILES | Cc1cc(CSCC/N=C(\N)C(C)[N+](=O)[O-])sc1CN1CCCCC1 |
| InChI | InChI=1S/C17H28N4O2S2/c1-13-10-15(25-16(13)11-20-7-4-3-5-8-20)12-24-9-6-19-17(18)14(2)21(22)23/h10,14H,3-9,11-12H2,1-2H3,(H2,18,19) |
| InChIKey | SLNJCFCJPBAALO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|