C6H7N3O4 — CID 57041348
N'-(2,5-dihydroxypyrrol-1-yl)oxamide (PubChem CID 57041348) has the molecular formula C6H7N3O4 and a molecular weight of 185.14 g/mol. Its IUPAC name is N'-(2,5-dihydroxypyrrol-1-yl)oxamide.
| Compound Name | N'-(2,5-dihydroxypyrrol-1-yl)oxamide |
|---|---|
| PubChem CID | 57041348 |
| Molecular Formula | C6H7N3O4 |
| Molecular Weight | 185.14 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | N'-(2,5-dihydroxypyrrol-1-yl)oxamide |
| SMILES | NC(=O)C(=O)Nn1c(O)ccc1O |
| InChI | InChI=1S/C6H7N3O4/c7-5(12)6(13)8-9-3(10)1-2-4(9)11/h1-2,10-11H,(H2,7,12)(H,8,13) |
| InChIKey | NBTUQDGJSCGVMS-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 117.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.14 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|