C17H30O2 — CID 57041390
2-tert-butyl-2-(3,5-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane (PubChem CID 57041390) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is 2-tert-butyl-2-(3,5-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane.
| Compound Name | 2-tert-butyl-2-(3,5-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 57041390 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | 2-tert-butyl-2-(3,5-dimethylcyclohex-3-en-1-yl)-5-methyl-1,3-dioxane |
| SMILES | CC1=CC(C)CC(C2(C(C)(C)C)OCC(C)CO2)C1 |
| InChI | InChI=1S/C17H30O2/c1-12-7-13(2)9-15(8-12)17(16(4,5)6)18-10-14(3)11-19-17/h7,12,14-15H,8-11H2,1-6H3 |
| InChIKey | CFPDRYMOMCETLU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|