About 9-(4,5-dimethoxy-2-nitrophenoxy)purine
9-(4,5-dimethoxy-2-nitrophenoxy)purine (PubChem CID 57046912) has the molecular formula C13H11N5O5
and a molecular weight of 317.26 g/mol. Its IUPAC name is 9-(4,5-dimethoxy-2-nitrophenoxy)purine.
Molecular Properties
| Compound Name | 9-(4,5-dimethoxy-2-nitrophenoxy)purine |
| PubChem CID | 57046912 |
| Molecular Formula | C13H11N5O5 |
| Molecular Weight | 317.26 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 9-(4,5-dimethoxy-2-nitrophenoxy)purine |
| SMILES | COc1cc(On2cnc3cncnc32)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C13H11N5O5/c1-21-11-3-9(18(19)20)10(4-12(11)22-2)23-17-7-16-8-5-14-6-15-13(8)17/h3-7H,1-2H3 |
| InChIKey | CEZDJHMSUJZICC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-(4,5-dimethoxy-2-nitrophenoxy)purine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4,5-dimethoxy-2-nitrophenoxy)purine?
The IUPAC name of 9-(4,5-dimethoxy-2-nitrophenoxy)purine (CID 57046912) is 9-(4,5-dimethoxy-2-nitrophenoxy)purine.
What is the SMILES notation for 9-(4,5-dimethoxy-2-nitrophenoxy)purine?
The canonical SMILES for 9-(4,5-dimethoxy-2-nitrophenoxy)purine is COc1cc(On2cnc3cncnc32)c([N+](=O)[O-])cc1OC.
What is the InChIKey of 9-(4,5-dimethoxy-2-nitrophenoxy)purine?
The InChIKey is CEZDJHMSUJZICC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N5O5/c1-21-11-3-9(18(19)20)10(4-12(11)22-2)23-17-7-16-8-5-14-6-15-13(8)17/h3-7H,1-2H3.
What are the key properties of 9-(4,5-dimethoxy-2-nitrophenoxy)purine?
9-(4,5-dimethoxy-2-nitrophenoxy)purine has a molecular weight of 317.26 g/mol, XLogP of 1.59, 5 rotatable bonds, 0 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4,5-dimethoxy-2-nitrophenoxy)purine is sourced from PubChem (CID 57046912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).