C21H30O3 — CID 57050689
(3,5-dicyclohexyl-4-hydroxyphenyl) propanoate (PubChem CID 57050689) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is (3,5-dicyclohexyl-4-hydroxyphenyl) propanoate.
| Compound Name | (3,5-dicyclohexyl-4-hydroxyphenyl) propanoate |
|---|---|
| PubChem CID | 57050689 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | (3,5-dicyclohexyl-4-hydroxyphenyl) propanoate |
| SMILES | CCC(=O)Oc1cc(C2CCCCC2)c(O)c(C2CCCCC2)c1 |
| InChI | InChI=1S/C21H30O3/c1-2-20(22)24-17-13-18(15-9-5-3-6-10-15)21(23)19(14-17)16-11-7-4-8-12-16/h13-16,23H,2-12H2,1H3 |
| InChIKey | VYBCIBCNXKIATK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|