About 1-nitrospiro[3H-indole-2,2'-thiochromene]
1-nitrospiro[3H-indole-2,2'-thiochromene] (PubChem CID 57052720) has the molecular formula C16H12N2O2S
and a molecular weight of 296.35 g/mol. Its IUPAC name is 1-nitrospiro[3H-indole-2,2'-thiochromene].
Molecular Properties
| Compound Name | 1-nitrospiro[3H-indole-2,2'-thiochromene] |
| PubChem CID | 57052720 |
| Molecular Formula | C16H12N2O2S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 1-nitrospiro[3H-indole-2,2'-thiochromene] |
| SMILES | O=[N+]([O-])N1c2ccccc2CC12C=Cc1ccccc1S2 |
| InChI | InChI=1S/C16H12N2O2S/c19-18(20)17-14-7-3-1-6-13(14)11-16(17)10-9-12-5-2-4-8-15(12)21-16/h1-10H,11H2 |
| InChIKey | RNESGRRJNUJISU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitrospiro[3H-indole-2,2'-thiochromene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitrospiro[3H-indole-2,2'-thiochromene]?
The IUPAC name of 1-nitrospiro[3H-indole-2,2'-thiochromene] (CID 57052720) is 1-nitrospiro[3H-indole-2,2'-thiochromene].
What is the SMILES notation for 1-nitrospiro[3H-indole-2,2'-thiochromene]?
The canonical SMILES for 1-nitrospiro[3H-indole-2,2'-thiochromene] is O=[N+]([O-])N1c2ccccc2CC12C=Cc1ccccc1S2.
What is the InChIKey of 1-nitrospiro[3H-indole-2,2'-thiochromene]?
The InChIKey is RNESGRRJNUJISU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2S/c19-18(20)17-14-7-3-1-6-13(14)11-16(17)10-9-12-5-2-4-8-15(12)21-16/h1-10H,11H2.
What are the key properties of 1-nitrospiro[3H-indole-2,2'-thiochromene]?
1-nitrospiro[3H-indole-2,2'-thiochromene] has a molecular weight of 296.35 g/mol, XLogP of 3.76, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitrospiro[3H-indole-2,2'-thiochromene] is sourced from PubChem (CID 57052720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).