C24H36O5Si — CID 57053596
[3-methoxy-3-(2-methoxyethoxy)butoxy]-[(2-methylpropan-2-yl)oxy]-diphenylsilane (PubChem CID 57053596) has the molecular formula C24H36O5Si and a molecular weight of 432.63 g/mol. Its IUPAC name is [3-methoxy-3-(2-methoxyethoxy)butoxy]-[(2-methylpropan-2-yl)oxy]-diphenylsilane.
| Compound Name | [3-methoxy-3-(2-methoxyethoxy)butoxy]-[(2-methylpropan-2-yl)oxy]-diphenylsilane |
|---|---|
| PubChem CID | 57053596 |
| Molecular Formula | C24H36O5Si |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | [3-methoxy-3-(2-methoxyethoxy)butoxy]-[(2-methylpropan-2-yl)oxy]-diphenylsilane |
| SMILES | COCCOC(C)(CCO[Si](OC(C)(C)C)(c1ccccc1)c1ccccc1)OC |
| InChI | InChI=1S/C24H36O5Si/c1-23(2,3)29-30(21-13-9-7-10-14-21,22-15-11-8-12-16-22)28-18-17-24(4,26-6)27-20-19-25-5/h7-16H,17-20H2,1-6H3 |
| InChIKey | NUCRZNLCXRWFSE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|