C20H23N3O3 — CID 57056088
3-(3,4-dihydro-2H-chromen-6-yl)-2-[[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]methyl]prop-2-enamide (PubChem CID 57056088) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-chromen-6-yl)-2-[[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]methyl]prop-2-enamide.
| Compound Name | 3-(3,4-dihydro-2H-chromen-6-yl)-2-[[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 57056088 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | 3-(3,4-dihydro-2H-chromen-6-yl)-2-[[[(2R)-2-hydroxy-2-pyridin-3-ylethyl]amino]methyl]prop-2-enamide |
| SMILES | NC(=O)C(=Cc1ccc2c(c1)CCCO2)CNC[C@H](O)c1cccnc1 |
| InChI | InChI=1S/C20H23N3O3/c21-20(25)17(12-23-13-18(24)16-3-1-7-22-11-16)10-14-5-6-19-15(9-14)4-2-8-26-19/h1,3,5-7,9-11,18,23-24H,2,4,8,12-13H2,(H2,21,25)/t18-/m0/s1 |
| InChIKey | JXZOEBMZTWBYDB-SFHVURJKSA-N |
| XLogP | 1.60 |
| TPSA | 97.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|