C22H26N2O5 — CID 57056570
[(1S,2R)-1-phenyl-2-(phenylmethoxycarbonylamino)propyl] 3-ethoxy-3-iminopropanoate (PubChem CID 57056570) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is [(1S,2R)-1-phenyl-2-(phenylmethoxycarbonylamino)propyl] 3-ethoxy-3-iminopropanoate.
| Compound Name | [(1S,2R)-1-phenyl-2-(phenylmethoxycarbonylamino)propyl] 3-ethoxy-3-iminopropanoate |
|---|---|
| PubChem CID | 57056570 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | [(1S,2R)-1-phenyl-2-(phenylmethoxycarbonylamino)propyl] 3-ethoxy-3-iminopropanoate |
| SMILES | [H]/N=C(/CC(=O)O[C@@H](c1ccccc1)[C@@H](C)NC(=O)OCc1ccccc1)OCC |
| InChI | InChI=1S/C22H26N2O5/c1-3-27-19(23)14-20(25)29-21(18-12-8-5-9-13-18)16(2)24-22(26)28-15-17-10-6-4-7-11-17/h4-13,16,21,23H,3,14-15H2,1-2H3,(H,24,26)/b23-19-/t16-,21-/m1/s1 |
| InChIKey | DQELMOMTRUQSMZ-CJWFJJABSA-N |
| XLogP | 3.99 |
| TPSA | 97.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|