C31H58N2O12 — CID 57057303
3-[(3-butoxy-2-hydroxypropyl)-[3-[(3-butoxy-2-hydroxypropyl)-[3-(2-oxobutanoyloxy)propyl]amino]-3,3-dihydroxypropyl]amino]propyl 2-oxobutanoate (PubChem CID 57057303) has the molecular formula C31H58N2O12 and a molecular weight of 650.81 g/mol. Its IUPAC name is 3-[(3-butoxy-2-hydroxypropyl)-[3-[(3-butoxy-2-hydroxypropyl)-[3-(2-oxobutanoyloxy)propyl]amino]-3,3-dihydroxypropyl]amino]propyl 2-oxobutanoate.
| Compound Name | 3-[(3-butoxy-2-hydroxypropyl)-[3-[(3-butoxy-2-hydroxypropyl)-[3-(2-oxobutanoyloxy)propyl]amino]-3,3-dihydroxypropyl]amino]propyl 2-oxobutanoate |
|---|---|
| PubChem CID | 57057303 |
| Molecular Formula | C31H58N2O12 |
| Molecular Weight | 650.81 g/mol |
| Exact Mass | 650.40 |
| IUPAC Name | 3-[(3-butoxy-2-hydroxypropyl)-[3-[(3-butoxy-2-hydroxypropyl)-[3-(2-oxobutanoyloxy)propyl]amino]-3,3-dihydroxypropyl]amino]propyl 2-oxobutanoate |
| SMILES | CCCCOCC(O)CN(CCCOC(=O)C(=O)CC)CCC(O)(O)N(CCCOC(=O)C(=O)CC)CC(O)COCCCC |
| InChI | InChI=1S/C31H58N2O12/c1-5-9-17-42-23-25(34)21-32(14-11-19-44-29(38)27(36)7-3)16-13-31(40,41)33(22-26(35)24-43-18-10-6-2)15-12-20-45-30(39)28(37)8-4/h25-26,34-35,40-41H,5-24H2,1-4H3 |
| InChIKey | YKZDKEAUSFFQGT-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 192.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.81 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|