C31H50N2O18 — CID 57281890
3-[[3-[bis[3-(2-oxobutanoyloxy)propyl]amino]-1,1,2,2,3,3-hexahydroxypropyl]-[3-(2-oxobutanoyloxy)propyl]amino]propyl 2-oxobutanoate (PubChem CID 57281890) has the molecular formula C31H50N2O18 and a molecular weight of 738.74 g/mol. Its IUPAC name is 3-[[3-[bis[3-(2-oxobutanoyloxy)propyl]amino]-1,1,2,2,3,3-hexahydroxypropyl]-[3-(2-oxobutanoyloxy)propyl]amino]propyl 2-oxobutanoate.
| Compound Name | 3-[[3-[bis[3-(2-oxobutanoyloxy)propyl]amino]-1,1,2,2,3,3-hexahydroxypropyl]-[3-(2-oxobutanoyloxy)propyl]amino]propyl 2-oxobutanoate |
|---|---|
| PubChem CID | 57281890 |
| Molecular Formula | C31H50N2O18 |
| Molecular Weight | 738.74 g/mol |
| Exact Mass | 738.31 |
| IUPAC Name | 3-[[3-[bis[3-(2-oxobutanoyloxy)propyl]amino]-1,1,2,2,3,3-hexahydroxypropyl]-[3-(2-oxobutanoyloxy)propyl]amino]propyl 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)OCCCN(CCCOC(=O)C(=O)CC)C(O)(O)C(O)(O)C(O)(O)N(CCCOC(=O)C(=O)CC)CCCOC(=O)C(=O)CC |
| InChI | InChI=1S/C31H50N2O18/c1-5-21(34)25(38)48-17-9-13-32(14-10-18-49-26(39)22(35)6-2)30(44,45)29(42,43)31(46,47)33(15-11-19-50-27(40)23(36)7-3)16-12-20-51-28(41)24(37)8-4/h42-47H,5-20H2,1-4H3 |
| InChIKey | YOTHAZDMOZLBNB-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 301.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.74 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|