C27H44O15 — CID 57034283
3-[1,3,6-trihydroxy-4,5-bis[3-(2-oxobutanoyloxy)propoxy]hexan-2-yl]oxypropyl 2-oxobutanoate (PubChem CID 57034283) has the molecular formula C27H44O15 and a molecular weight of 608.63 g/mol. Its IUPAC name is 3-[1,3,6-trihydroxy-4,5-bis[3-(2-oxobutanoyloxy)propoxy]hexan-2-yl]oxypropyl 2-oxobutanoate.
| Compound Name | 3-[1,3,6-trihydroxy-4,5-bis[3-(2-oxobutanoyloxy)propoxy]hexan-2-yl]oxypropyl 2-oxobutanoate |
|---|---|
| PubChem CID | 57034283 |
| Molecular Formula | C27H44O15 |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | 3-[1,3,6-trihydroxy-4,5-bis[3-(2-oxobutanoyloxy)propoxy]hexan-2-yl]oxypropyl 2-oxobutanoate |
| SMILES | CCC(=O)C(=O)OCCCOC(CO)C(O)C(OCCCOC(=O)C(=O)CC)C(CO)OCCCOC(=O)C(=O)CC |
| InChI | InChI=1S/C27H44O15/c1-4-18(30)25(34)40-13-7-10-37-21(16-28)23(33)24(39-12-9-15-42-27(36)20(32)6-3)22(17-29)38-11-8-14-41-26(35)19(31)5-2/h21-24,28-29,33H,4-17H2,1-3H3 |
| InChIKey | XLVWJGKGBBBQIV-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 218.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|