C27H22N4O2S — CID 57057579
N-[4-[2-(1-benzofuran-2-yl)ethylcarbamothioylamino]phenyl]isoquinoline-1-carboxamide (PubChem CID 57057579) has the molecular formula C27H22N4O2S and a molecular weight of 466.57 g/mol. Its IUPAC name is N-[4-[2-(1-benzofuran-2-yl)ethylcarbamothioylamino]phenyl]isoquinoline-1-carboxamide.
| Compound Name | N-[4-[2-(1-benzofuran-2-yl)ethylcarbamothioylamino]phenyl]isoquinoline-1-carboxamide |
|---|---|
| PubChem CID | 57057579 |
| Molecular Formula | C27H22N4O2S |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | N-[4-[2-(1-benzofuran-2-yl)ethylcarbamothioylamino]phenyl]isoquinoline-1-carboxamide |
| SMILES | O=C(Nc1ccc(NC(=S)NCCc2cc3ccccc3o2)cc1)c1nccc2ccccc12 |
| InChI | InChI=1S/C27H22N4O2S/c32-26(25-23-7-3-1-5-18(23)13-15-28-25)30-20-9-11-21(12-10-20)31-27(34)29-16-14-22-17-19-6-2-4-8-24(19)33-22/h1-13,15,17H,14,16H2,(H,30,32)(H2,29,31,34) |
| InChIKey | ALZZJFKUFMLQCV-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|