C24H20FN3O2S — CID 15955718
N-[4-[2-(1-benzofuran-2-yl)ethylcarbamothioylamino]phenyl]-2-fluorobenzamide (PubChem CID 15955718) has the molecular formula C24H20FN3O2S and a molecular weight of 433.51 g/mol. Its IUPAC name is N-[4-[2-(1-benzofuran-2-yl)ethylcarbamothioylamino]phenyl]-2-fluorobenzamide.
| Compound Name | N-[4-[2-(1-benzofuran-2-yl)ethylcarbamothioylamino]phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 15955718 |
| Molecular Formula | C24H20FN3O2S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | N-[4-[2-(1-benzofuran-2-yl)ethylcarbamothioylamino]phenyl]-2-fluorobenzamide |
| SMILES | O=C(Nc1ccc(NC(=S)NCCc2cc3ccccc3o2)cc1)c1ccccc1F |
| InChI | InChI=1S/C24H20FN3O2S/c25-21-7-3-2-6-20(21)23(29)27-17-9-11-18(12-10-17)28-24(31)26-14-13-19-15-16-5-1-4-8-22(16)30-19/h1-12,15H,13-14H2,(H,27,29)(H2,26,28,31) |
| InChIKey | FBOCPBSEVJRVHE-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 66.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|