C25H33NO3S2 — CID 57057604
5-[2-(4-aminophenyl)ethyl]-3-(2-tert-butyl-5-methylthiophen-3-yl)sulfanyl-6-propan-2-yloxane-2,4-dione (PubChem CID 57057604) has the molecular formula C25H33NO3S2 and a molecular weight of 459.68 g/mol. Its IUPAC name is 5-[2-(4-aminophenyl)ethyl]-3-(2-tert-butyl-5-methylthiophen-3-yl)sulfanyl-6-propan-2-yloxane-2,4-dione.
| Compound Name | 5-[2-(4-aminophenyl)ethyl]-3-(2-tert-butyl-5-methylthiophen-3-yl)sulfanyl-6-propan-2-yloxane-2,4-dione |
|---|---|
| PubChem CID | 57057604 |
| Molecular Formula | C25H33NO3S2 |
| Molecular Weight | 459.68 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | 5-[2-(4-aminophenyl)ethyl]-3-(2-tert-butyl-5-methylthiophen-3-yl)sulfanyl-6-propan-2-yloxane-2,4-dione |
| SMILES | Cc1cc(SC2C(=O)OC(C(C)C)C(CCc3ccc(N)cc3)C2=O)c(C(C)(C)C)s1 |
| InChI | InChI=1S/C25H33NO3S2/c1-14(2)21-18(12-9-16-7-10-17(26)11-8-16)20(27)22(24(28)29-21)31-19-13-15(3)30-23(19)25(4,5)6/h7-8,10-11,13-14,18,21-22H,9,12,26H2,1-6H3 |
| InChIKey | BAVCHFHRIKMTAL-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.68 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|