C49H45N7O3 — CID 57060331
4-[2-[[6-ethyl-8-[[4-phenyl-3-(2-trityltetrazol-5-yl)phenyl]methoxy]-1,5-naphthyridin-2-yl]oxy]ethyl]morpholine (PubChem CID 57060331) has the molecular formula C49H45N7O3 and a molecular weight of 779.94 g/mol. Its IUPAC name is 4-[2-[[6-ethyl-8-[[4-phenyl-3-(2-trityltetrazol-5-yl)phenyl]methoxy]-1,5-naphthyridin-2-yl]oxy]ethyl]morpholine.
| Compound Name | 4-[2-[[6-ethyl-8-[[4-phenyl-3-(2-trityltetrazol-5-yl)phenyl]methoxy]-1,5-naphthyridin-2-yl]oxy]ethyl]morpholine |
|---|---|
| PubChem CID | 57060331 |
| Molecular Formula | C49H45N7O3 |
| Molecular Weight | 779.94 g/mol |
| Exact Mass | 779.36 |
| IUPAC Name | 4-[2-[[6-ethyl-8-[[4-phenyl-3-(2-trityltetrazol-5-yl)phenyl]methoxy]-1,5-naphthyridin-2-yl]oxy]ethyl]morpholine |
| SMILES | CCc1cc(OCc2ccc(-c3ccccc3)c(-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)c2)c2nc(OCCN3CCOCC3)ccc2n1 |
| InChI | InChI=1S/C49H45N7O3/c1-2-41-34-45(47-44(50-41)25-26-46(51-47)58-32-29-55-27-30-57-31-28-55)59-35-36-23-24-42(37-15-7-3-8-16-37)43(33-36)48-52-54-56(53-48)49(38-17-9-4-10-18-38,39-19-11-5-12-20-39)40-21-13-6-14-22-40/h3-26,33-34H,2,27-32,35H2,1H3 |
| InChIKey | RLRKVFSLINXYSS-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 100.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.94 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|