C47H36N6O — CID 57142702
4-[2,6-dimethyl-4-[[4-phenyl-3-(2-trityltetrazol-5-yl)phenyl]methoxy]-3-pyridinyl]benzonitrile (PubChem CID 57142702) has the molecular formula C47H36N6O and a molecular weight of 700.85 g/mol. Its IUPAC name is 4-[2,6-dimethyl-4-[[4-phenyl-3-(2-trityltetrazol-5-yl)phenyl]methoxy]-3-pyridinyl]benzonitrile.
| Compound Name | 4-[2,6-dimethyl-4-[[4-phenyl-3-(2-trityltetrazol-5-yl)phenyl]methoxy]-3-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 57142702 |
| Molecular Formula | C47H36N6O |
| Molecular Weight | 700.85 g/mol |
| Exact Mass | 700.30 |
| IUPAC Name | 4-[2,6-dimethyl-4-[[4-phenyl-3-(2-trityltetrazol-5-yl)phenyl]methoxy]-3-pyridinyl]benzonitrile |
| SMILES | Cc1cc(OCc2ccc(-c3ccccc3)c(-c3nnn(C(c4ccccc4)(c4ccccc4)c4ccccc4)n3)c2)c(-c2ccc(C#N)cc2)c(C)n1 |
| InChI | InChI=1S/C47H36N6O/c1-33-29-44(45(34(2)49-33)38-26-23-35(31-48)24-27-38)54-32-36-25-28-42(37-15-7-3-8-16-37)43(30-36)46-50-52-53(51-46)47(39-17-9-4-10-18-39,40-19-11-5-12-20-40)41-21-13-6-14-22-41/h3-30H,32H2,1-2H3 |
| InChIKey | YNIPMQLNMJNBHP-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 89.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.85 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|